C26H26N6O — CID 135928473
[4-[3-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazol-6-yl]phenyl]methanol (PubChem CID 135928473) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is [4-[3-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazol-6-yl]phenyl]methanol.
| Compound Name | [4-[3-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazol-6-yl]phenyl]methanol |
|---|---|
| PubChem CID | 135928473 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [4-[3-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazol-6-yl]phenyl]methanol |
| SMILES | CN1CCN(c2cccc3[nH]c(-c4n[nH]c5cc(-c6ccc(CO)cc6)ccc45)nc23)CC1 |
| InChI | InChI=1S/C26H26N6O/c1-31-11-13-32(14-12-31)23-4-2-3-21-25(23)28-26(27-21)24-20-10-9-19(15-22(20)29-30-24)18-7-5-17(16-33)6-8-18/h2-10,15,33H,11-14,16H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | XJMUQSPFRGDRSM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |