C20H19N5O — CID 135687549
5-[3-[(dimethylamino)methyl]-1H-indol-2-yl]-3-pyridin-4-yl-1H-pyridazin-6-one (PubChem CID 135687549) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 5-[3-[(dimethylamino)methyl]-1H-indol-2-yl]-3-pyridin-4-yl-1H-pyridazin-6-one.
| Compound Name | 5-[3-[(dimethylamino)methyl]-1H-indol-2-yl]-3-pyridin-4-yl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 135687549 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 5-[3-[(dimethylamino)methyl]-1H-indol-2-yl]-3-pyridin-4-yl-1H-pyridazin-6-one |
| SMILES | CN(C)Cc1c(-c2cc(-c3ccncc3)n[nH]c2=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H19N5O/c1-25(2)12-16-14-5-3-4-6-17(14)22-19(16)15-11-18(23-24-20(15)26)13-7-9-21-10-8-13/h3-11,22H,12H2,1-2H3,(H,24,26) |
| InChIKey | FFLMJDWUFYLMBT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |