C23H16N4O2 — CID 135961881
3-(6-oxo-1H-pyridin-3-yl)-5-(3-phenyl-1H-indol-2-yl)-1H-pyridazin-6-one (PubChem CID 135961881) has the molecular formula C23H16N4O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 3-(6-oxo-1H-pyridin-3-yl)-5-(3-phenyl-1H-indol-2-yl)-1H-pyridazin-6-one.
| Compound Name | 3-(6-oxo-1H-pyridin-3-yl)-5-(3-phenyl-1H-indol-2-yl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 135961881 |
| Molecular Formula | C23H16N4O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-(6-oxo-1H-pyridin-3-yl)-5-(3-phenyl-1H-indol-2-yl)-1H-pyridazin-6-one |
| SMILES | O=c1ccc(-c2cc(-c3[nH]c4ccccc4c3-c3ccccc3)c(=O)[nH]n2)c[nH]1 |
| InChI | InChI=1S/C23H16N4O2/c28-20-11-10-15(13-24-20)19-12-17(23(29)27-26-19)22-21(14-6-2-1-3-7-14)16-8-4-5-9-18(16)25-22/h1-13,25H,(H,24,28)(H,27,29) |
| InChIKey | OQIRBDKFJIZRBM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |