C27H26FN3O2S — CID 135687873
2-(4-fluorophenyl)-5-(4-methoxyphenyl)-4-[C-methyl-N-[2-(4-methylphenyl)sulfanylethyl]carbonimidoyl]-1H-pyrazol-3-one (PubChem CID 135687873) has the molecular formula C27H26FN3O2S and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(4-methoxyphenyl)-4-[C-methyl-N-[2-(4-methylphenyl)sulfanylethyl]carbonimidoyl]-1H-pyrazol-3-one.
| Compound Name | 2-(4-fluorophenyl)-5-(4-methoxyphenyl)-4-[C-methyl-N-[2-(4-methylphenyl)sulfanylethyl]carbonimidoyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135687873 |
| Molecular Formula | C27H26FN3O2S |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(4-methoxyphenyl)-4-[C-methyl-N-[2-(4-methylphenyl)sulfanylethyl]carbonimidoyl]-1H-pyrazol-3-one |
| SMILES | COc1ccc(-c2[nH]n(-c3ccc(F)cc3)c(=O)c2/C(C)=N/CCSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H26FN3O2S/c1-18-4-14-24(15-5-18)34-17-16-29-19(2)25-26(20-6-12-23(33-3)13-7-20)30-31(27(25)32)22-10-8-21(28)9-11-22/h4-15,30H,16-17H2,1-3H3/b29-19+ |
| InChIKey | CGLACIBUIVCABN-VUTHCHCSSA-N |
| XLogP | 5.89 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|