C16H9IN2O5 — CID 135688964
(4Z)-4-[(2-hydroxy-3-nitrophenyl)methylidene]-3-(3-iodophenyl)-1,2-oxazol-5-one (PubChem CID 135688964) has the molecular formula C16H9IN2O5 and a molecular weight of 436.16 g/mol. Its IUPAC name is (4Z)-4-[(2-hydroxy-3-nitrophenyl)methylidene]-3-(3-iodophenyl)-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-[(2-hydroxy-3-nitrophenyl)methylidene]-3-(3-iodophenyl)-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 135688964 |
| Molecular Formula | C16H9IN2O5 |
| Molecular Weight | 436.16 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | (4Z)-4-[(2-hydroxy-3-nitrophenyl)methylidene]-3-(3-iodophenyl)-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2cccc(I)c2)/C1=C/c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H9IN2O5/c17-11-5-1-3-9(7-11)14-12(16(21)24-18-14)8-10-4-2-6-13(15(10)20)19(22)23/h1-8,20H/b12-8- |
| InChIKey | LYTAVWWTACQPSI-WQLSENKSSA-N |
| XLogP | 3.25 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.16 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|