C26H22N4O5 — CID 135689432
(3E)-1-ethyl-3-[[3-(1-ethyl-4-hydroxy-2-oxoquinolin-3-yl)-5-oxo-1,2-dihydropyrazol-4-yl]methylidene]quinoline-2,4-dione (PubChem CID 135689432) has the molecular formula C26H22N4O5 and a molecular weight of 470.49 g/mol. Its IUPAC name is (3E)-1-ethyl-3-[[3-(1-ethyl-4-hydroxy-2-oxoquinolin-3-yl)-5-oxo-1,2-dihydropyrazol-4-yl]methylidene]quinoline-2,4-dione.
| Compound Name | (3E)-1-ethyl-3-[[3-(1-ethyl-4-hydroxy-2-oxoquinolin-3-yl)-5-oxo-1,2-dihydropyrazol-4-yl]methylidene]quinoline-2,4-dione |
|---|---|
| PubChem CID | 135689432 |
| Molecular Formula | C26H22N4O5 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (3E)-1-ethyl-3-[[3-(1-ethyl-4-hydroxy-2-oxoquinolin-3-yl)-5-oxo-1,2-dihydropyrazol-4-yl]methylidene]quinoline-2,4-dione |
| SMILES | CCN1C(=O)/C(=C/c2c(-c3c(O)c4ccccc4n(CC)c3=O)[nH][nH]c2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H22N4O5/c1-3-29-18-11-7-5-9-14(18)22(31)17(25(29)34)13-16-21(27-28-24(16)33)20-23(32)15-10-6-8-12-19(15)30(4-2)26(20)35/h5-13,32H,3-4H2,1-2H3,(H2,27,28,33)/b17-13+ |
| InChIKey | HBUXCYLWEZXWJH-GHRIWEEISA-N |
| XLogP | 3.04 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|