C20H15N3O3 — CID 3599663
1-methyl-3-[(3-oxo-5-phenyl-1,2-dihydropyrazol-4-yl)methylidene]quinoline-2,4-dione (PubChem CID 3599663) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 1-methyl-3-[(3-oxo-5-phenyl-1,2-dihydropyrazol-4-yl)methylidene]quinoline-2,4-dione.
| Compound Name | 1-methyl-3-[(3-oxo-5-phenyl-1,2-dihydropyrazol-4-yl)methylidene]quinoline-2,4-dione |
|---|---|
| PubChem CID | 3599663 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-methyl-3-[(3-oxo-5-phenyl-1,2-dihydropyrazol-4-yl)methylidene]quinoline-2,4-dione |
| SMILES | CN1C(=O)C(=Cc2c(-c3ccccc3)[nH][nH]c2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H15N3O3/c1-23-16-10-6-5-9-13(16)18(24)15(20(23)26)11-14-17(21-22-19(14)25)12-7-3-2-4-8-12/h2-11H,1H3,(H2,21,22,25) |
| InChIKey | PIYKRJVXDBUWNC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|