C17H15N3O5S — CID 135690652
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 135690652) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 135690652 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | O=C(CN1C(=O)[C@H]2CC=CC[C@H]2C1=O)OCc1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H15N3O5S/c21-13(7-20-16(23)9-3-1-2-4-10(9)17(20)24)25-8-12-18-11-5-6-26-14(11)15(22)19-12/h1-2,5-6,9-10H,3-4,7-8H2,(H,18,19,22)/t9-,10+ |
| InChIKey | AWEMJLDDQUPVDZ-AOOOYVTPSA-N |
| XLogP | 0.98 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|