C16H12N2O5S — CID 135690708
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-(4-formylphenoxy)acetate (PubChem CID 135690708) has the molecular formula C16H12N2O5S and a molecular weight of 344.35 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-(4-formylphenoxy)acetate.
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-(4-formylphenoxy)acetate |
|---|---|
| PubChem CID | 135690708 |
| Molecular Formula | C16H12N2O5S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-(4-formylphenoxy)acetate |
| SMILES | O=Cc1ccc(OCC(=O)OCc2nc3ccsc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C16H12N2O5S/c19-7-10-1-3-11(4-2-10)22-9-14(20)23-8-13-17-12-5-6-24-15(12)16(21)18-13/h1-7H,8-9H2,(H,17,18,21) |
| InChIKey | QGOIVXIVFXMAKV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|