C12H12IN3O2S — CID 135691853
N-(4-iodophenyl)-2-[(5S)-2-methylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135691853) has the molecular formula C12H12IN3O2S and a molecular weight of 389.22 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-[(5S)-2-methylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-iodophenyl)-2-[(5S)-2-methylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135691853 |
| Molecular Formula | C12H12IN3O2S |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | N-(4-iodophenyl)-2-[(5S)-2-methylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | C/N=C1\NC(=O)[C@H](CC(=O)Nc2ccc(I)cc2)S1 |
| InChI | InChI=1S/C12H12IN3O2S/c1-14-12-16-11(18)9(19-12)6-10(17)15-8-4-2-7(13)3-5-8/h2-5,9H,6H2,1H3,(H,15,17)(H,14,16,18)/t9-/m0/s1 |
| InChIKey | YYNUZJZPSAXCLS-VIFPVBQESA-N |
| XLogP | 1.84 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|