C18H14N2O — CID 135692550
1-(6-methylindolizino[1,2-c]quinolin-12-yl)ethanone (PubChem CID 135692550) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(6-methylindolizino[1,2-c]quinolin-12-yl)ethanone.
| Compound Name | 1-(6-methylindolizino[1,2-c]quinolin-12-yl)ethanone |
|---|---|
| PubChem CID | 135692550 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-(6-methylindolizino[1,2-c]quinolin-12-yl)ethanone |
| SMILES | CC(=O)c1c2c3ccccc3nc(C)c2c2ccccn12 |
| InChI | InChI=1S/C18H14N2O/c1-11-16-15-9-5-6-10-20(15)18(12(2)21)17(16)13-7-3-4-8-14(13)19-11/h3-10H,1-2H3 |
| InChIKey | ISVQSEFHLURJJN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |