C13H16N2O — CID 84681820
1-(2-tert-butylimidazo[1,2-a]pyridin-3-yl)ethanone (PubChem CID 84681820) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(2-tert-butylimidazo[1,2-a]pyridin-3-yl)ethanone.
| Compound Name | 1-(2-tert-butylimidazo[1,2-a]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 84681820 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-(2-tert-butylimidazo[1,2-a]pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1c(C(C)(C)C)nc2ccccn12 |
| InChI | InChI=1S/C13H16N2O/c1-9(16)11-12(13(2,3)4)14-10-7-5-6-8-15(10)11/h5-8H,1-4H3 |
| InChIKey | VSENJIZOHVEHBB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |