C11H12N2O — CID 76849304
1-(2-ethylimidazo[1,2-a]pyridin-3-yl)ethanone (PubChem CID 76849304) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 1-(2-ethylimidazo[1,2-a]pyridin-3-yl)ethanone.
| Compound Name | 1-(2-ethylimidazo[1,2-a]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 76849304 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 1-(2-ethylimidazo[1,2-a]pyridin-3-yl)ethanone |
| SMILES | CCc1nc2ccccn2c1C(C)=O |
| InChI | InChI=1S/C11H12N2O/c1-3-9-11(8(2)14)13-7-5-4-6-10(13)12-9/h4-7H,3H2,1-2H3 |
| InChIKey | MJZHZCIYMVJHNB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |