C19H22N4O — CID 1495259
N-[4-(dimethylamino)phenyl]-N-(2-ethylimidazo[1,2-a]pyridin-3-yl)acetamide (PubChem CID 1495259) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-N-(2-ethylimidazo[1,2-a]pyridin-3-yl)acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-N-(2-ethylimidazo[1,2-a]pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 1495259 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-N-(2-ethylimidazo[1,2-a]pyridin-3-yl)acetamide |
| SMILES | CCc1nc2ccccn2c1N(C(C)=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H22N4O/c1-5-17-19(22-13-7-6-8-18(22)20-17)23(14(2)24)16-11-9-15(10-12-16)21(3)4/h6-13H,5H2,1-4H3 |
| InChIKey | GAYAVPAUMKRDJS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|