C20H20N4O2 — CID 70240552
N-[4-(dimethylamino)phenyl]-7-hydroxy-8,9-dihydropyrido[1,2-a]benzimidazole-6-carboxamide (PubChem CID 70240552) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-7-hydroxy-8,9-dihydropyrido[1,2-a]benzimidazole-6-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-7-hydroxy-8,9-dihydropyrido[1,2-a]benzimidazole-6-carboxamide |
|---|---|
| PubChem CID | 70240552 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-7-hydroxy-8,9-dihydropyrido[1,2-a]benzimidazole-6-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2=C(O)CCc3c2nc2ccccn32)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-23(2)14-8-6-13(7-9-14)21-20(26)18-16(25)11-10-15-19(18)22-17-5-3-4-12-24(15)17/h3-9,12,25H,10-11H2,1-2H3,(H,21,26) |
| InChIKey | TZJJBKWMRNRXRJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|