C17H19N5OS — CID 2622659
(2R)-N-[4-(dimethylamino)phenyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanamide (PubChem CID 2622659) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is (2R)-N-[4-(dimethylamino)phenyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanamide.
| Compound Name | (2R)-N-[4-(dimethylamino)phenyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 2622659 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (2R)-N-[4-(dimethylamino)phenyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanamide |
| SMILES | C[C@@H](Sc1nnc2ccccn12)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H19N5OS/c1-12(24-17-20-19-15-6-4-5-11-22(15)17)16(23)18-13-7-9-14(10-8-13)21(2)3/h4-12H,1-3H3,(H,18,23)/t12-/m1/s1 |
| InChIKey | GSQLHZRGHKBRHK-GFCCVEGCSA-N |
| XLogP | 2.91 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|