C17H23N5OS — CID 25409442
(2R)-N-[4-(dimethylamino)phenyl]-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 25409442) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is (2R)-N-[4-(dimethylamino)phenyl]-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-[4-(dimethylamino)phenyl]-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 25409442 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (2R)-N-[4-(dimethylamino)phenyl]-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(C)nnc1S[C@H](C)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H23N5OS/c1-6-11-22-13(3)19-20-17(22)24-12(2)16(23)18-14-7-9-15(10-8-14)21(4)5/h6-10,12H,1,11H2,2-5H3,(H,18,23)/t12-/m1/s1 |
| InChIKey | NUABDRNHTJGMBF-GFCCVEGCSA-N |
| XLogP | 2.96 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|