C14H17N5O2S2 — CID 46618740
2-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanoylamino]thiophene-3-carboxamide (PubChem CID 46618740) has the molecular formula C14H17N5O2S2 and a molecular weight of 351.46 g/mol. Its IUPAC name is 2-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanoylamino]thiophene-3-carboxamide.
| Compound Name | 2-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanoylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 46618740 |
| Molecular Formula | C14H17N5O2S2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanoylamino]thiophene-3-carboxamide |
| SMILES | C=CCn1c(C)nnc1SC(C)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C14H17N5O2S2/c1-4-6-19-9(3)17-18-14(19)23-8(2)12(21)16-13-10(11(15)20)5-7-22-13/h4-5,7-8H,1,6H2,2-3H3,(H2,15,20)(H,16,21) |
| InChIKey | DIKAIBHZOXHCNP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|