C14H16N4O2S2 — CID 18141467
2-[2-(1-cyclopropylimidazol-2-yl)sulfanylpropanoylamino]thiophene-3-carboxamide (PubChem CID 18141467) has the molecular formula C14H16N4O2S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[2-(1-cyclopropylimidazol-2-yl)sulfanylpropanoylamino]thiophene-3-carboxamide.
| Compound Name | 2-[2-(1-cyclopropylimidazol-2-yl)sulfanylpropanoylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 18141467 |
| Molecular Formula | C14H16N4O2S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[2-(1-cyclopropylimidazol-2-yl)sulfanylpropanoylamino]thiophene-3-carboxamide |
| SMILES | CC(Sc1nccn1C1CC1)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C14H16N4O2S2/c1-8(22-14-16-5-6-18(14)9-2-3-9)12(20)17-13-10(11(15)19)4-7-21-13/h4-9H,2-3H2,1H3,(H2,15,19)(H,17,20) |
| InChIKey | HCONUGQXIIMQJX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |