C16H16ClN5OS — CID 78655209
N-(3-chloro-4-cyanophenyl)-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 78655209) has the molecular formula C16H16ClN5OS and a molecular weight of 361.86 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 78655209 |
| Molecular Formula | C16H16ClN5OS |
| Molecular Weight | 361.86 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(C)nnc1SC(C)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C16H16ClN5OS/c1-4-7-22-11(3)20-21-16(22)24-10(2)15(23)19-13-6-5-12(9-18)14(17)8-13/h4-6,8,10H,1,7H2,2-3H3,(H,19,23) |
| InChIKey | IYDXZZANLUPBHG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|