C13H13ClN6OS — CID 27144173
(2R)-N-(3-chloro-4-cyanophenyl)-2-(1-ethyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 27144173) has the molecular formula C13H13ClN6OS and a molecular weight of 336.81 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-cyanophenyl)-2-(1-ethyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-(3-chloro-4-cyanophenyl)-2-(1-ethyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 27144173 |
| Molecular Formula | C13H13ClN6OS |
| Molecular Weight | 336.81 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | (2R)-N-(3-chloro-4-cyanophenyl)-2-(1-ethyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | CCn1nnnc1S[C@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H13ClN6OS/c1-3-20-13(17-18-19-20)22-8(2)12(21)16-10-5-4-9(7-15)11(14)6-10/h4-6,8H,3H2,1-2H3,(H,16,21)/t8-/m1/s1 |
| InChIKey | RILVELYXBLMXKG-MRVPVSSYSA-N |
| XLogP | 2.34 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.81 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |