C25H28N4O2 — CID 43822189
N-(2-cyclohex-3-en-1-ylimidazo[1,2-a]pyridin-3-yl)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 43822189) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-(2-cyclohex-3-en-1-ylimidazo[1,2-a]pyridin-3-yl)-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | N-(2-cyclohex-3-en-1-ylimidazo[1,2-a]pyridin-3-yl)-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43822189 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-(2-cyclohex-3-en-1-ylimidazo[1,2-a]pyridin-3-yl)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CC(=O)N(c1ccc(N2CCOCC2)cc1)c1c(C2CC=CCC2)nc2ccccn12 |
| InChI | InChI=1S/C25H28N4O2/c1-19(30)29(22-12-10-21(11-13-22)27-15-17-31-18-16-27)25-24(20-7-3-2-4-8-20)26-23-9-5-6-14-28(23)25/h2-3,5-6,9-14,20H,4,7-8,15-18H2,1H3 |
| InChIKey | QFPULBVNFKWNAY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|