C29H35N5O3 — CID 46948251
3-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-ethyl-N-[2-(4-methoxyphenoxy)ethyl]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 46948251) has the molecular formula C29H35N5O3 and a molecular weight of 501.63 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-ethyl-N-[2-(4-methoxyphenoxy)ethyl]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 3-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-ethyl-N-[2-(4-methoxyphenoxy)ethyl]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 46948251 |
| Molecular Formula | C29H35N5O3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-ethyl-N-[2-(4-methoxyphenoxy)ethyl]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCc1nc2ccc(C(=O)NCCOc3ccc(OC)cc3)cn2c1N(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C29H35N5O3/c1-6-26-29(33(4)19-21-7-10-23(11-8-21)32(2)3)34-20-22(9-16-27(34)31-26)28(35)30-17-18-37-25-14-12-24(36-5)13-15-25/h7-16,20H,6,17-19H2,1-5H3,(H,30,35) |
| InChIKey | RXVGUHMZSCBDJE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|