C15H15N3O3S — CID 135693154
(2Z)-2-[(E)-(3-methoxy-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one (PubChem CID 135693154) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is (2Z)-2-[(E)-(3-methoxy-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(E)-(3-methoxy-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135693154 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (2Z)-2-[(E)-(3-methoxy-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1ccc(/C=N/N=C2/NC(=O)C(C)S2)cc1OC |
| InChI | InChI=1S/C15H15N3O3S/c1-4-7-21-12-6-5-11(8-13(12)20-3)9-16-18-15-17-14(19)10(2)22-15/h1,5-6,8-10H,7H2,2-3H3,(H,17,18,19)/b16-9+ |
| InChIKey | VEBUUQYEYLBGBE-CXUHLZMHSA-N |
| XLogP | 1.65 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|