C18H17N3O4S — CID 168621141
2-[4-oxo-2-[(3-prop-2-enyl-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168621141) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-[4-oxo-2-[(3-prop-2-enyl-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[4-oxo-2-[(3-prop-2-enyl-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168621141 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[4-oxo-2-[(3-prop-2-enyl-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | C#CCOc1ccc(C=NN=C2NC(=O)C(CC(=O)O)S2)cc1CC=C |
| InChI | InChI=1S/C18H17N3O4S/c1-3-5-13-9-12(6-7-14(13)25-8-4-2)11-19-21-18-20-17(24)15(26-18)10-16(22)23/h2-3,6-7,9,11,15H,1,5,8,10H2,(H,22,23)(H,20,21,24) |
| InChIKey | CTIQFOYDPBKHBH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|