C16H13N5O4S — CID 135693225
N'-[2-[[5-(4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]pyridine-4-carbohydrazide (PubChem CID 135693225) has the molecular formula C16H13N5O4S and a molecular weight of 371.38 g/mol. Its IUPAC name is N'-[2-[[5-(4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[2-[[5-(4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 135693225 |
| Molecular Formula | C16H13N5O4S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N'-[2-[[5-(4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]pyridine-4-carbohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccc(O)cc2)o1)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C16H13N5O4S/c22-12-3-1-11(2-4-12)15-20-21-16(25-15)26-9-13(23)18-19-14(24)10-5-7-17-8-6-10/h1-8,22H,9H2,(H,18,23)(H,19,24) |
| InChIKey | LGUOIERRHRFHEB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|