C24H19F3N2O2 — CID 135693271
4-[4-ethyl-3-(4-hydroxyphenyl)-1-[2-(trifluoromethyl)phenyl]pyrazol-5-yl]phenol (PubChem CID 135693271) has the molecular formula C24H19F3N2O2 and a molecular weight of 424.42 g/mol. Its IUPAC name is 4-[4-ethyl-3-(4-hydroxyphenyl)-1-[2-(trifluoromethyl)phenyl]pyrazol-5-yl]phenol.
| Compound Name | 4-[4-ethyl-3-(4-hydroxyphenyl)-1-[2-(trifluoromethyl)phenyl]pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 135693271 |
| Molecular Formula | C24H19F3N2O2 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 4-[4-ethyl-3-(4-hydroxyphenyl)-1-[2-(trifluoromethyl)phenyl]pyrazol-5-yl]phenol |
| SMILES | CCc1c(-c2ccc(O)cc2)nn(-c2ccccc2C(F)(F)F)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C24H19F3N2O2/c1-2-19-22(15-7-11-17(30)12-8-15)28-29(23(19)16-9-13-18(31)14-10-16)21-6-4-3-5-20(21)24(25,26)27/h3-14,30-31H,2H2,1H3 |
| InChIKey | JSZIMPYTDUUKSX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |