C15H19N5OS2 — CID 135694211
2-butylsulfanyl-5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135694211) has the molecular formula C15H19N5OS2 and a molecular weight of 349.49 g/mol. Its IUPAC name is 2-butylsulfanyl-5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-butylsulfanyl-5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135694211 |
| Molecular Formula | C15H19N5OS2 |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-butylsulfanyl-5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1cccs1)C(C(N)=O)=C(C)N2 |
| InChI | InChI=1S/C15H19N5OS2/c1-3-4-7-23-15-18-14-17-9(2)11(13(16)21)12(20(14)19-15)10-6-5-8-22-10/h5-6,8,12H,3-4,7H2,1-2H3,(H2,16,21)(H,17,18,19) |
| InChIKey | PEASAEBMPLMYBM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|