C23H31BrN4O4S — CID 135695874
butyl 7-(3-bromo-4,5-diethoxyphenyl)-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135695874) has the molecular formula C23H31BrN4O4S and a molecular weight of 539.50 g/mol. Its IUPAC name is butyl 7-(3-bromo-4,5-diethoxyphenyl)-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | butyl 7-(3-bromo-4,5-diethoxyphenyl)-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135695874 |
| Molecular Formula | C23H31BrN4O4S |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | butyl 7-(3-bromo-4,5-diethoxyphenyl)-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)Nc2nc(SCC)nn2C1c1cc(Br)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C23H31BrN4O4S/c1-6-10-11-32-21(29)18-14(5)25-22-26-23(33-9-4)27-28(22)19(18)15-12-16(24)20(31-8-3)17(13-15)30-7-2/h12-13,19H,6-11H2,1-5H3,(H,25,26,27) |
| InChIKey | ZTBMXFAHDMWDID-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|