C27H30Cl2N4O4S — CID 135695890
butyl 7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135695890) has the molecular formula C27H30Cl2N4O4S and a molecular weight of 577.53 g/mol. Its IUPAC name is butyl 7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | butyl 7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135695890 |
| Molecular Formula | C27H30Cl2N4O4S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | butyl 7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)Nc2nc(SCC)nn2C1c1ccc(OCc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C27H30Cl2N4O4S/c1-5-7-12-36-25(34)23-16(3)30-26-31-27(38-6-2)32-33(26)24(23)17-9-11-21(22(13-17)35-4)37-15-18-8-10-19(28)14-20(18)29/h8-11,13-14,24H,5-7,12,15H2,1-4H3,(H,30,31,32) |
| InChIKey | YUMBQGPZEUVDKK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|