C26H26Cl2N4O4S — CID 135695738
prop-2-enyl 7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135695738) has the molecular formula C26H26Cl2N4O4S and a molecular weight of 561.49 g/mol. Its IUPAC name is prop-2-enyl 7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135695738 |
| Molecular Formula | C26H26Cl2N4O4S |
| Molecular Weight | 561.49 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | prop-2-enyl 7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2nc(SCC)nn2C1c1ccc(OCc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C26H26Cl2N4O4S/c1-5-11-35-24(33)22-15(3)29-25-30-26(37-6-2)31-32(25)23(22)16-8-10-20(21(12-16)34-4)36-14-17-7-9-18(27)13-19(17)28/h5,7-10,12-13,23H,1,6,11,14H2,2-4H3,(H,29,30,31) |
| InChIKey | WBFWJDZUIYCUFS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|