C24H32N4O4S — CID 135694472
prop-2-enyl 2-butylsulfanyl-7-(3-methoxy-4-propoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135694472) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is prop-2-enyl 2-butylsulfanyl-7-(3-methoxy-4-propoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 2-butylsulfanyl-7-(3-methoxy-4-propoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135694472 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | prop-2-enyl 2-butylsulfanyl-7-(3-methoxy-4-propoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2nc(SCCCC)nn2C1c1ccc(OCCC)c(OC)c1 |
| InChI | InChI=1S/C24H32N4O4S/c1-6-9-14-33-24-26-23-25-16(4)20(22(29)32-13-8-3)21(28(23)27-24)17-10-11-18(31-12-7-2)19(15-17)30-5/h8,10-11,15,21H,3,6-7,9,12-14H2,1-2,4-5H3,(H,25,26,27) |
| InChIKey | ZVNSMMQFLGUDGG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|