C23H32N4O4S — CID 136761576
ethyl (7S)-7-(3,4-dimethoxyphenyl)-2-hexylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136761576) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is ethyl (7S)-7-(3,4-dimethoxyphenyl)-2-hexylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (7S)-7-(3,4-dimethoxyphenyl)-2-hexylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136761576 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | ethyl (7S)-7-(3,4-dimethoxyphenyl)-2-hexylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCSc1nc2n(n1)[C@@H](c1ccc(OC)c(OC)c1)C(C(=O)OCC)=C(C)N2 |
| InChI | InChI=1S/C23H32N4O4S/c1-6-8-9-10-13-32-23-25-22-24-15(3)19(21(28)31-7-2)20(27(22)26-23)16-11-12-17(29-4)18(14-16)30-5/h11-12,14,20H,6-10,13H2,1-5H3,(H,24,25,26)/t20-/m0/s1 |
| InChIKey | VXLRTSDMQYHJPV-FQEVSTJZSA-N |
| XLogP | 4.82 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|