C34H33Cl3N4O4S — CID 135791254
cyclohexyl 2-[(2-chlorophenyl)methylsulfanyl]-7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791254) has the molecular formula C34H33Cl3N4O4S and a molecular weight of 700.09 g/mol. Its IUPAC name is cyclohexyl 2-[(2-chlorophenyl)methylsulfanyl]-7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 2-[(2-chlorophenyl)methylsulfanyl]-7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791254 |
| Molecular Formula | C34H33Cl3N4O4S |
| Molecular Weight | 700.09 g/mol |
| Exact Mass | 698.13 |
| IUPAC Name | cyclohexyl 2-[(2-chlorophenyl)methylsulfanyl]-7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COc1cc(C2C(C(=O)OC3CCCCC3)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C34H33Cl3N4O4S/c1-20-30(32(42)45-25-9-4-3-5-10-25)31(41-33(38-20)39-34(40-41)46-19-23-8-6-7-11-26(23)36)21-13-15-28(29(16-21)43-2)44-18-22-12-14-24(35)17-27(22)37/h6-8,11-17,25,31H,3-5,9-10,18-19H2,1-2H3,(H,38,39,40) |
| InChIKey | XMUZFKAPRTVVIS-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.09 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |