C33H31Cl2FN4O3S — CID 135791776
cyclohexyl 7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791776) has the molecular formula C33H31Cl2FN4O3S and a molecular weight of 653.61 g/mol. Its IUPAC name is cyclohexyl 7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791776 |
| Molecular Formula | C33H31Cl2FN4O3S |
| Molecular Weight | 653.61 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | cyclohexyl 7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCC2)C(c2ccc(OCc3ccc(Cl)cc3Cl)cc2)n2nc(SCc3ccccc3F)nc2N1 |
| InChI | InChI=1S/C33H31Cl2FN4O3S/c1-20-29(31(41)43-26-8-3-2-4-9-26)30(21-12-15-25(16-13-21)42-18-22-11-14-24(34)17-27(22)35)40-32(37-20)38-33(39-40)44-19-23-7-5-6-10-28(23)36/h5-7,10-17,26,30H,2-4,8-9,18-19H2,1H3,(H,37,38,39) |
| InChIKey | NMVQZYHZCYKSER-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.61 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |