C34H27Cl3N4O3S — CID 135790811
benzyl 2-[(2-chlorophenyl)methylsulfanyl]-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135790811) has the molecular formula C34H27Cl3N4O3S and a molecular weight of 678.04 g/mol. Its IUPAC name is benzyl 2-[(2-chlorophenyl)methylsulfanyl]-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | benzyl 2-[(2-chlorophenyl)methylsulfanyl]-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135790811 |
| Molecular Formula | C34H27Cl3N4O3S |
| Molecular Weight | 678.04 g/mol |
| Exact Mass | 676.09 |
| IUPAC Name | benzyl 2-[(2-chlorophenyl)methylsulfanyl]-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(c2ccc(OCc3ccc(Cl)cc3Cl)cc2)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C34H27Cl3N4O3S/c1-21-30(32(42)44-18-22-7-3-2-4-8-22)31(23-12-15-27(16-13-23)43-19-24-11-14-26(35)17-29(24)37)41-33(38-21)39-34(40-41)45-20-25-9-5-6-10-28(25)36/h2-17,31H,18-20H2,1H3,(H,38,39,40) |
| InChIKey | VCSVMSMFJOQAQK-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.04 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |