C28H24Cl2N4O2S — CID 135792808
1-[2-benzylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone (PubChem CID 135792808) has the molecular formula C28H24Cl2N4O2S and a molecular weight of 551.50 g/mol. Its IUPAC name is 1-[2-benzylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone.
| Compound Name | 1-[2-benzylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
|---|---|
| PubChem CID | 135792808 |
| Molecular Formula | C28H24Cl2N4O2S |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 1-[2-benzylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
| SMILES | CC(=O)C1=C(C)Nc2nc(SCc3ccccc3)nn2C1c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C28H24Cl2N4O2S/c1-17-25(18(2)35)26(34-27(31-17)32-28(33-34)37-16-19-6-4-3-5-7-19)20-9-12-23(13-10-20)36-15-21-8-11-22(29)14-24(21)30/h3-14,26H,15-16H2,1-2H3,(H,31,32,33) |
| InChIKey | ZHAQFKQNYWFVHQ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |