C25H26Cl2N4O2S — CID 135694700
1-[2-butylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone (PubChem CID 135694700) has the molecular formula C25H26Cl2N4O2S and a molecular weight of 517.48 g/mol. Its IUPAC name is 1-[2-butylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone.
| Compound Name | 1-[2-butylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
|---|---|
| PubChem CID | 135694700 |
| Molecular Formula | C25H26Cl2N4O2S |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 1-[2-butylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(OCc3ccc(Cl)cc3Cl)cc1)C(C(C)=O)=C(C)N2 |
| InChI | InChI=1S/C25H26Cl2N4O2S/c1-4-5-12-34-25-29-24-28-15(2)22(16(3)32)23(31(24)30-25)17-7-10-20(11-8-17)33-14-18-6-9-19(26)13-21(18)27/h6-11,13,23H,4-5,12,14H2,1-3H3,(H,28,29,30) |
| InChIKey | XOTHZYRLEGJCKU-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|