C24H24Cl2N4O2S — CID 135807389
1-[7-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone (PubChem CID 135807389) has the molecular formula C24H24Cl2N4O2S and a molecular weight of 503.46 g/mol. Its IUPAC name is 1-[7-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone.
| Compound Name | 1-[7-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
|---|---|
| PubChem CID | 135807389 |
| Molecular Formula | C24H24Cl2N4O2S |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 1-[7-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
| SMILES | CCCSc1nc2n(n1)C(c1ccccc1OCc1ccc(Cl)cc1Cl)C(C(C)=O)=C(C)N2 |
| InChI | InChI=1S/C24H24Cl2N4O2S/c1-4-11-33-24-28-23-27-14(2)21(15(3)31)22(30(23)29-24)18-7-5-6-8-20(18)32-13-16-9-10-17(25)12-19(16)26/h5-10,12,22H,4,11,13H2,1-3H3,(H,27,28,29) |
| InChIKey | JZPJZHLTWGCRGR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |