C26H28Cl2N4O3S — CID 135807253
propan-2-yl 7-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135807253) has the molecular formula C26H28Cl2N4O3S and a molecular weight of 547.51 g/mol. Its IUPAC name is propan-2-yl 7-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 7-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135807253 |
| Molecular Formula | C26H28Cl2N4O3S |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | propan-2-yl 7-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCSc1nc2n(n1)C(c1cccc(OCc3ccc(Cl)cc3Cl)c1)C(C(=O)OC(C)C)=C(C)N2 |
| InChI | InChI=1S/C26H28Cl2N4O3S/c1-5-11-36-26-30-25-29-16(4)22(24(33)35-15(2)3)23(32(25)31-26)17-7-6-8-20(12-17)34-14-18-9-10-19(27)13-21(18)28/h6-10,12-13,15,23H,5,11,14H2,1-4H3,(H,29,30,31) |
| InChIKey | JBIUSLCRTVIVSJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |