C30H28Cl2N4O3S — CID 135793015
propan-2-yl 2-benzylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135793015) has the molecular formula C30H28Cl2N4O3S and a molecular weight of 595.55 g/mol. Its IUPAC name is propan-2-yl 2-benzylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 2-benzylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135793015 |
| Molecular Formula | C30H28Cl2N4O3S |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | propan-2-yl 2-benzylsulfanyl-7-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccc(OCc3ccc(Cl)cc3Cl)cc2)n2nc(SCc3ccccc3)nc2N1 |
| InChI | InChI=1S/C30H28Cl2N4O3S/c1-18(2)39-28(37)26-19(3)33-29-34-30(40-17-20-7-5-4-6-8-20)35-36(29)27(26)21-10-13-24(14-11-21)38-16-22-9-12-23(31)15-25(22)32/h4-15,18,27H,16-17H2,1-3H3,(H,33,34,35) |
| InChIKey | AUCCWIJJKJVQQU-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |