C34H43ClN4O4S — CID 135791335
cyclohexyl 2-[(2-chlorophenyl)methylsulfanyl]-7-(3-ethoxy-4-hexoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791335) has the molecular formula C34H43ClN4O4S and a molecular weight of 639.26 g/mol. Its IUPAC name is cyclohexyl 2-[(2-chlorophenyl)methylsulfanyl]-7-(3-ethoxy-4-hexoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 2-[(2-chlorophenyl)methylsulfanyl]-7-(3-ethoxy-4-hexoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791335 |
| Molecular Formula | C34H43ClN4O4S |
| Molecular Weight | 639.26 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | cyclohexyl 2-[(2-chlorophenyl)methylsulfanyl]-7-(3-ethoxy-4-hexoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCOc1ccc(C2C(C(=O)OC3CCCCC3)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)cc1OCC |
| InChI | InChI=1S/C34H43ClN4O4S/c1-4-6-7-13-20-42-28-19-18-24(21-29(28)41-5-2)31-30(32(40)43-26-15-9-8-10-16-26)23(3)36-33-37-34(38-39(31)33)44-22-25-14-11-12-17-27(25)35/h11-12,14,17-19,21,26,31H,4-10,13,15-16,20,22H2,1-3H3,(H,36,37,38) |
| InChIKey | ZRDTYBFGKRQDDN-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.26 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|