C34H42BrFN4O4S — CID 135791724
cyclohexyl 7-(3-bromo-5-ethoxy-4-hexoxyphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791724) has the molecular formula C34H42BrFN4O4S and a molecular weight of 701.70 g/mol. Its IUPAC name is cyclohexyl 7-(3-bromo-5-ethoxy-4-hexoxyphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 7-(3-bromo-5-ethoxy-4-hexoxyphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791724 |
| Molecular Formula | C34H42BrFN4O4S |
| Molecular Weight | 701.70 g/mol |
| Exact Mass | 700.21 |
| IUPAC Name | cyclohexyl 7-(3-bromo-5-ethoxy-4-hexoxyphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCOc1c(Br)cc(C2C(C(=O)OC3CCCCC3)=C(C)Nc3nc(SCc4ccccc4F)nn32)cc1OCC |
| InChI | InChI=1S/C34H42BrFN4O4S/c1-4-6-7-13-18-43-31-26(35)19-24(20-28(31)42-5-2)30-29(32(41)44-25-15-9-8-10-16-25)22(3)37-33-38-34(39-40(30)33)45-21-23-14-11-12-17-27(23)36/h11-12,14,17,19-20,25,30H,4-10,13,15-16,18,21H2,1-3H3,(H,37,38,39) |
| InChIKey | NNRFXFSIMDTJJQ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.70 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|