C33H41BrN4O4S — CID 135791490
cyclohexyl 2-benzylsulfanyl-7-(3-bromo-4-hexoxy-5-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791490) has the molecular formula C33H41BrN4O4S and a molecular weight of 669.69 g/mol. Its IUPAC name is cyclohexyl 2-benzylsulfanyl-7-(3-bromo-4-hexoxy-5-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 2-benzylsulfanyl-7-(3-bromo-4-hexoxy-5-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791490 |
| Molecular Formula | C33H41BrN4O4S |
| Molecular Weight | 669.69 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | cyclohexyl 2-benzylsulfanyl-7-(3-bromo-4-hexoxy-5-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCOc1c(Br)cc(C2C(C(=O)OC3CCCCC3)=C(C)Nc3nc(SCc4ccccc4)nn32)cc1OC |
| InChI | InChI=1S/C33H41BrN4O4S/c1-4-5-6-13-18-41-30-26(34)19-24(20-27(30)40-3)29-28(31(39)42-25-16-11-8-12-17-25)22(2)35-32-36-33(37-38(29)32)43-21-23-14-9-7-10-15-23/h7,9-10,14-15,19-20,25,29H,4-6,8,11-13,16-18,21H2,1-3H3,(H,35,36,37) |
| InChIKey | YMSXWJFRWCZPJI-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.69 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|