C29H33BrN4O3S — CID 135791605
cyclohexyl 2-benzylsulfanyl-7-(5-bromo-2-propoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791605) has the molecular formula C29H33BrN4O3S and a molecular weight of 597.58 g/mol. Its IUPAC name is cyclohexyl 2-benzylsulfanyl-7-(5-bromo-2-propoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 2-benzylsulfanyl-7-(5-bromo-2-propoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791605 |
| Molecular Formula | C29H33BrN4O3S |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | cyclohexyl 2-benzylsulfanyl-7-(5-bromo-2-propoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCOc1ccc(Br)cc1C1C(C(=O)OC2CCCCC2)=C(C)Nc2nc(SCc3ccccc3)nn21 |
| InChI | InChI=1S/C29H33BrN4O3S/c1-3-16-36-24-15-14-21(30)17-23(24)26-25(27(35)37-22-12-8-5-9-13-22)19(2)31-28-32-29(33-34(26)28)38-18-20-10-6-4-7-11-20/h4,6-7,10-11,14-15,17,22,26H,3,5,8-9,12-13,16,18H2,1-2H3,(H,31,32,33) |
| InChIKey | NMUYCMGMOIOEFY-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |