C29H34N4O5S — CID 135791614
cyclohexyl 2-benzylsulfanyl-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791614) has the molecular formula C29H34N4O5S and a molecular weight of 550.68 g/mol. Its IUPAC name is cyclohexyl 2-benzylsulfanyl-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 2-benzylsulfanyl-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791614 |
| Molecular Formula | C29H34N4O5S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | cyclohexyl 2-benzylsulfanyl-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COc1cc(C2C(C(=O)OC3CCCCC3)=C(C)Nc3nc(SCc4ccccc4)nn32)cc(OC)c1OC |
| InChI | InChI=1S/C29H34N4O5S/c1-18-24(27(34)38-21-13-9-6-10-14-21)25(20-15-22(35-2)26(37-4)23(16-20)36-3)33-28(30-18)31-29(32-33)39-17-19-11-7-5-8-12-19/h5,7-8,11-12,15-16,21,25H,6,9-10,13-14,17H2,1-4H3,(H,30,31,32) |
| InChIKey | NAUBVPLHOGIZRO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |