C35H37BrN4O4S — CID 135791560
cyclohexyl 2-benzylsulfanyl-7-[4-[(3-bromophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791560) has the molecular formula C35H37BrN4O4S and a molecular weight of 689.68 g/mol. Its IUPAC name is cyclohexyl 2-benzylsulfanyl-7-[4-[(3-bromophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 2-benzylsulfanyl-7-[4-[(3-bromophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791560 |
| Molecular Formula | C35H37BrN4O4S |
| Molecular Weight | 689.68 g/mol |
| Exact Mass | 688.17 |
| IUPAC Name | cyclohexyl 2-benzylsulfanyl-7-[4-[(3-bromophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOc1cc(C2C(C(=O)OC3CCCCC3)=C(C)Nc3nc(SCc4ccccc4)nn32)ccc1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C35H37BrN4O4S/c1-3-42-30-20-26(17-18-29(30)43-21-25-13-10-14-27(36)19-25)32-31(33(41)44-28-15-8-5-9-16-28)23(2)37-34-38-35(39-40(32)34)45-22-24-11-6-4-7-12-24/h4,6-7,10-14,17-20,28,32H,3,5,8-9,15-16,21-22H2,1-2H3,(H,37,38,39) |
| InChIKey | WBVOYTBKSSSNDD-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.68 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |