C33H40BrN5O5S — CID 135791514
cyclohexyl 2-benzylsulfanyl-7-[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791514) has the molecular formula C33H40BrN5O5S and a molecular weight of 698.68 g/mol. Its IUPAC name is cyclohexyl 2-benzylsulfanyl-7-[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 2-benzylsulfanyl-7-[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791514 |
| Molecular Formula | C33H40BrN5O5S |
| Molecular Weight | 698.68 g/mol |
| Exact Mass | 697.19 |
| IUPAC Name | cyclohexyl 2-benzylsulfanyl-7-[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCN(CC)C(=O)COc1c(Br)cc(C2C(C(=O)OC3CCCCC3)=C(C)Nc3nc(SCc4ccccc4)nn32)cc1OC |
| InChI | InChI=1S/C33H40BrN5O5S/c1-5-38(6-2)27(40)19-43-30-25(34)17-23(18-26(30)42-4)29-28(31(41)44-24-15-11-8-12-16-24)21(3)35-32-36-33(37-39(29)32)45-20-22-13-9-7-10-14-22/h7,9-10,13-14,17-18,24,29H,5-6,8,11-12,15-16,19-20H2,1-4H3,(H,35,36,37) |
| InChIKey | IYSXCDDOFPJNMC-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.68 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |