C32H38BrClN4O4S — CID 135791300
cyclohexyl 7-[3-bromo-5-methoxy-4-(3-methylbutoxy)phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791300) has the molecular formula C32H38BrClN4O4S and a molecular weight of 690.10 g/mol. Its IUPAC name is cyclohexyl 7-[3-bromo-5-methoxy-4-(3-methylbutoxy)phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 7-[3-bromo-5-methoxy-4-(3-methylbutoxy)phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791300 |
| Molecular Formula | C32H38BrClN4O4S |
| Molecular Weight | 690.10 g/mol |
| Exact Mass | 688.15 |
| IUPAC Name | cyclohexyl 7-[3-bromo-5-methoxy-4-(3-methylbutoxy)phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COc1cc(C2C(C(=O)OC3CCCCC3)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)cc(Br)c1OCCC(C)C |
| InChI | InChI=1S/C32H38BrClN4O4S/c1-19(2)14-15-41-29-24(33)16-22(17-26(29)40-4)28-27(30(39)42-23-11-6-5-7-12-23)20(3)35-31-36-32(37-38(28)31)43-18-21-10-8-9-13-25(21)34/h8-10,13,16-17,19,23,28H,5-7,11-12,14-15,18H2,1-4H3,(H,35,36,37) |
| InChIKey | VMPLCHDULLYDMZ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.10 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |