C37H42N4O3S — CID 135791577
cyclohexyl 2-benzylsulfanyl-7-[4-[(4-tert-butylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791577) has the molecular formula C37H42N4O3S and a molecular weight of 622.84 g/mol. Its IUPAC name is cyclohexyl 2-benzylsulfanyl-7-[4-[(4-tert-butylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 2-benzylsulfanyl-7-[4-[(4-tert-butylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791577 |
| Molecular Formula | C37H42N4O3S |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | cyclohexyl 2-benzylsulfanyl-7-[4-[(4-tert-butylphenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCC2)C(c2ccc(OCc3ccc(C(C)(C)C)cc3)cc2)n2nc(SCc3ccccc3)nc2N1 |
| InChI | InChI=1S/C37H42N4O3S/c1-25-32(34(42)44-31-13-9-6-10-14-31)33(41-35(38-25)39-36(40-41)45-24-27-11-7-5-8-12-27)28-17-21-30(22-18-28)43-23-26-15-19-29(20-16-26)37(2,3)4/h5,7-8,11-12,15-22,31,33H,6,9-10,13-14,23-24H2,1-4H3,(H,38,39,40) |
| InChIKey | HDNPLSFHBJXJCH-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |